C25H52O2Si2 — CID 135020041
tert-butyl-dimethyl-[[(1R,2R,3R)-1-methyl-3-prop-1-en-2-yl-2-tri(propan-2-yl)silyloxycyclopentyl]methoxy]silane (PubChem CID 135020041) has the molecular formula C25H52O2Si2 and a molecular weight of 440.86 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R,2R,3R)-1-methyl-3-prop-1-en-2-yl-2-tri(propan-2-yl)silyloxycyclopentyl]methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R,2R,3R)-1-methyl-3-prop-1-en-2-yl-2-tri(propan-2-yl)silyloxycyclopentyl]methoxy]silane |
|---|---|
| PubChem CID | 135020041 |
| Molecular Formula | C25H52O2Si2 |
| Molecular Weight | 440.86 g/mol |
| Exact Mass | 440.35 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R,2R,3R)-1-methyl-3-prop-1-en-2-yl-2-tri(propan-2-yl)silyloxycyclopentyl]methoxy]silane |
| SMILES | C=C(C)[C@H]1CC[C@](C)(CO[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H52O2Si2/c1-18(2)22-15-16-25(12,17-26-28(13,14)24(9,10)11)23(22)27-29(19(3)4,20(5)6)21(7)8/h19-23H,1,15-17H2,2-14H3/t22-,23-,25-/m1/s1 |
| InChIKey | WYNOBGBNODFCNW-VDKIKQQVSA-N |
| XLogP | 8.56 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.86 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|