C26H54O2Si2 — CID 135020039
trimethyl-[2-methyl-4-[(1R,2R,3R)-1-methyl-3-prop-1-en-2-yl-2-tri(propan-2-yl)silyloxycyclopentyl]butan-2-yl]oxysilane (PubChem CID 135020039) has the molecular formula C26H54O2Si2 and a molecular weight of 454.89 g/mol. Its IUPAC name is trimethyl-[2-methyl-4-[(1R,2R,3R)-1-methyl-3-prop-1-en-2-yl-2-tri(propan-2-yl)silyloxycyclopentyl]butan-2-yl]oxysilane.
| Compound Name | trimethyl-[2-methyl-4-[(1R,2R,3R)-1-methyl-3-prop-1-en-2-yl-2-tri(propan-2-yl)silyloxycyclopentyl]butan-2-yl]oxysilane |
|---|---|
| PubChem CID | 135020039 |
| Molecular Formula | C26H54O2Si2 |
| Molecular Weight | 454.89 g/mol |
| Exact Mass | 454.37 |
| IUPAC Name | trimethyl-[2-methyl-4-[(1R,2R,3R)-1-methyl-3-prop-1-en-2-yl-2-tri(propan-2-yl)silyloxycyclopentyl]butan-2-yl]oxysilane |
| SMILES | C=C(C)[C@H]1CC[C@](C)(CCC(C)(C)O[Si](C)(C)C)[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C26H54O2Si2/c1-19(2)23-15-16-26(11,18-17-25(9,10)28-29(12,13)14)24(23)27-30(20(3)4,21(5)6)22(7)8/h20-24H,1,15-18H2,2-14H3/t23-,24-,26-/m1/s1 |
| InChIKey | ZBHIDODNZUUSDH-DGWZTRNLSA-N |
| XLogP | 8.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.89 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|