C22H42OSi2 — CID 135031663
[(1R,3aE,6Z,9aR)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-1,3,5,8,9,9a-hexahydrocyclopenta[8]annulen-4-yl]-trimethylsilane (PubChem CID 135031663) has the molecular formula C22H42OSi2 and a molecular weight of 378.75 g/mol. Its IUPAC name is [(1R,3aE,6Z,9aR)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-1,3,5,8,9,9a-hexahydrocyclopenta[8]annulen-4-yl]-trimethylsilane.
| Compound Name | [(1R,3aE,6Z,9aR)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-1,3,5,8,9,9a-hexahydrocyclopenta[8]annulen-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 135031663 |
| Molecular Formula | C22H42OSi2 |
| Molecular Weight | 378.75 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | [(1R,3aE,6Z,9aR)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-1,3,5,8,9,9a-hexahydrocyclopenta[8]annulen-4-yl]-trimethylsilane |
| SMILES | CC1(C)C/C2=C(\[Si](C)(C)C)C/C=C\CC[C@H]2[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42OSi2/c1-21(2,3)25(9,10)23-20-17-14-12-11-13-15-19(24(6,7)8)18(17)16-22(20,4)5/h11,13,17,20H,12,14-16H2,1-10H3/b13-11-,19-18+/t17-,20-/m1/s1 |
| InChIKey | LKCDXAQFGHSWET-MOWNAVINSA-N |
| XLogP | 7.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.75 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|