C19H38O2Si2 — CID 134836522
[(5R,7aR)-1,1,3,3,5-pentamethyl-7,7a-dihydro-6H-cyclopenta[d]oxasilin-5-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 134836522) has the molecular formula C19H38O2Si2 and a molecular weight of 354.68 g/mol. Its IUPAC name is [(5R,7aR)-1,1,3,3,5-pentamethyl-7,7a-dihydro-6H-cyclopenta[d]oxasilin-5-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(5R,7aR)-1,1,3,3,5-pentamethyl-7,7a-dihydro-6H-cyclopenta[d]oxasilin-5-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134836522 |
| Molecular Formula | C19H38O2Si2 |
| Molecular Weight | 354.68 g/mol |
| Exact Mass | 354.24 |
| IUPAC Name | [(5R,7aR)-1,1,3,3,5-pentamethyl-7,7a-dihydro-6H-cyclopenta[d]oxasilin-5-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)O[Si](C)(C)C=C2[C@H]1CC[C@@]2(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H38O2Si2/c1-17(2,3)23(9,10)20-14-19(6)12-11-15-16(19)13-22(7,8)21-18(15,4)5/h13,15H,11-12,14H2,1-10H3/t15-,19+/m1/s1 |
| InChIKey | DXYXGJZIUVVSBX-BEFAXECRSA-N |
| XLogP | 5.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.68 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|