C22H44O2Si — CID 139253914
[(1S,3S)-2,2-diethyl-3-methoxy-5-prop-1-en-2-ylcyclopentyl]oxy-tri(propan-2-yl)silane (PubChem CID 139253914) has the molecular formula C22H44O2Si and a molecular weight of 368.68 g/mol. Its IUPAC name is [(1S,3S)-2,2-diethyl-3-methoxy-5-prop-1-en-2-ylcyclopentyl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(1S,3S)-2,2-diethyl-3-methoxy-5-prop-1-en-2-ylcyclopentyl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 139253914 |
| Molecular Formula | C22H44O2Si |
| Molecular Weight | 368.68 g/mol |
| Exact Mass | 368.31 |
| IUPAC Name | [(1S,3S)-2,2-diethyl-3-methoxy-5-prop-1-en-2-ylcyclopentyl]oxy-tri(propan-2-yl)silane |
| SMILES | C=C(C)C1C[C@H](OC)C(CC)(CC)[C@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H44O2Si/c1-12-22(13-2)20(23-11)14-19(15(3)4)21(22)24-25(16(5)6,17(7)8)18(9)10/h16-21H,3,12-14H2,1-2,4-11H3/t19?,20-,21-/m0/s1 |
| InChIKey | ZHAQCYLACHRLFR-AKQSQHNNSA-N |
| XLogP | 6.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.68 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|