C25H48O2Si — CID 139253916
[(1S,3S)-5-(cyclohexen-1-yl)-2,2-diethyl-3-methoxycyclopentyl]oxy-tri(propan-2-yl)silane (PubChem CID 139253916) has the molecular formula C25H48O2Si and a molecular weight of 408.74 g/mol. Its IUPAC name is [(1S,3S)-5-(cyclohexen-1-yl)-2,2-diethyl-3-methoxycyclopentyl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(1S,3S)-5-(cyclohexen-1-yl)-2,2-diethyl-3-methoxycyclopentyl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 139253916 |
| Molecular Formula | C25H48O2Si |
| Molecular Weight | 408.74 g/mol |
| Exact Mass | 408.34 |
| IUPAC Name | [(1S,3S)-5-(cyclohexen-1-yl)-2,2-diethyl-3-methoxycyclopentyl]oxy-tri(propan-2-yl)silane |
| SMILES | CCC1(CC)[C@@H](OC)CC(C2=CCCCC2)[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H48O2Si/c1-10-25(11-2)23(26-9)17-22(21-15-13-12-14-16-21)24(25)27-28(18(3)4,19(5)6)20(7)8/h15,18-20,22-24H,10-14,16-17H2,1-9H3/t22?,23-,24-/m0/s1 |
| InChIKey | XRQZJFZJVYLQLS-VYCPFJESSA-N |
| XLogP | 7.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.74 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|