C24H46OSi2 — CID 135031986
[(1E)-1-[(2R,3R)-2-but-3-enyl-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylcyclopentylidene]but-3-enyl]-trimethylsilane (PubChem CID 135031986) has the molecular formula C24H46OSi2 and a molecular weight of 406.80 g/mol. Its IUPAC name is [(1E)-1-[(2R,3R)-2-but-3-enyl-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylcyclopentylidene]but-3-enyl]-trimethylsilane.
| Compound Name | [(1E)-1-[(2R,3R)-2-but-3-enyl-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylcyclopentylidene]but-3-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 135031986 |
| Molecular Formula | C24H46OSi2 |
| Molecular Weight | 406.80 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | [(1E)-1-[(2R,3R)-2-but-3-enyl-3-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethylcyclopentylidene]but-3-enyl]-trimethylsilane |
| SMILES | C=CCC[C@@H]1/C(=C(\CC=C)[Si](C)(C)C)CC(C)(C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H46OSi2/c1-13-15-17-19-20(21(16-14-2)26(8,9)10)18-24(6,7)22(19)25-27(11,12)23(3,4)5/h13-14,19,22H,1-2,15-18H2,3-12H3/b21-20+/t19-,22-/m1/s1 |
| InChIKey | KFGABXPQLVCOMT-JRXQXTMRSA-N |
| XLogP | 8.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.80 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|