C28H54O3Si2 — CID 101362169
(1S,2R,3R,3aS,6R,7S,7aR)-3-[tert-butyl(dimethyl)silyl]oxy-6-[3-[tert-butyl(dimethyl)silyl]oxybutyl]-7-ethenyl-2-methyl-2,3,3a,6,7,7a-hexahydro-1H-inden-1-ol (PubChem CID 101362169) has the molecular formula C28H54O3Si2 and a molecular weight of 494.91 g/mol. Its IUPAC name is (1S,2R,3R,3aS,6R,7S,7aR)-3-[tert-butyl(dimethyl)silyl]oxy-6-[3-[tert-butyl(dimethyl)silyl]oxybutyl]-7-ethenyl-2-methyl-2,3,3a,6,7,7a-hexahydro-1H-inden-1-ol.
| Compound Name | (1S,2R,3R,3aS,6R,7S,7aR)-3-[tert-butyl(dimethyl)silyl]oxy-6-[3-[tert-butyl(dimethyl)silyl]oxybutyl]-7-ethenyl-2-methyl-2,3,3a,6,7,7a-hexahydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 101362169 |
| Molecular Formula | C28H54O3Si2 |
| Molecular Weight | 494.91 g/mol |
| Exact Mass | 494.36 |
| IUPAC Name | (1S,2R,3R,3aS,6R,7S,7aR)-3-[tert-butyl(dimethyl)silyl]oxy-6-[3-[tert-butyl(dimethyl)silyl]oxybutyl]-7-ethenyl-2-methyl-2,3,3a,6,7,7a-hexahydro-1H-inden-1-ol |
| SMILES | C=C[C@@H]1[C@H]2[C@H](O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2C=C[C@H]1CCC(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H54O3Si2/c1-14-22-21(16-15-19(2)30-32(10,11)27(4,5)6)17-18-23-24(22)25(29)20(3)26(23)31-33(12,13)28(7,8)9/h14,17-26,29H,1,15-16H2,2-13H3/t19?,20-,21-,22+,23+,24-,25-,26+/m1/s1 |
| InChIKey | KKJXJGNTUVLFIP-YAJMSNPNSA-N |
| XLogP | 7.80 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.91 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|