C27H54O3Si2 — CID 134973152
(E,3S)-1-[(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-ethenylcyclopentyl]oct-1-en-3-ol (PubChem CID 134973152) has the molecular formula C27H54O3Si2 and a molecular weight of 482.90 g/mol. Its IUPAC name is (E,3S)-1-[(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-ethenylcyclopentyl]oct-1-en-3-ol.
| Compound Name | (E,3S)-1-[(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-ethenylcyclopentyl]oct-1-en-3-ol |
|---|---|
| PubChem CID | 134973152 |
| Molecular Formula | C27H54O3Si2 |
| Molecular Weight | 482.90 g/mol |
| Exact Mass | 482.36 |
| IUPAC Name | (E,3S)-1-[(3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-ethenylcyclopentyl]oct-1-en-3-ol |
| SMILES | C=CC1C(/C=C/[C@@H](O)CCCCC)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H54O3Si2/c1-13-15-16-17-21(28)18-19-23-22(14-2)24(29-31(9,10)26(3,4)5)20-25(23)30-32(11,12)27(6,7)8/h14,18-19,21-25,28H,2,13,15-17,20H2,1,3-12H3/b19-18+/t21-,22?,23?,24+,25-/m0/s1 |
| InChIKey | FSMPFCAXNNNLPC-GYVRHQQHSA-N |
| XLogP | 8.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.90 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|