C15H28O2Si — CID 134855794
cis-(1S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-bis(ethenyl)cyclopentan-1-ol (PubChem CID 134855794) has the molecular formula C15H28O2Si and a molecular weight of 268.47 g/mol. Its IUPAC name is cis-(1S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-bis(ethenyl)cyclopentan-1-ol.
| Compound Name | cis-(1S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-bis(ethenyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 134855794 |
| Molecular Formula | C15H28O2Si |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | cis-(1S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2,3-bis(ethenyl)cyclopentan-1-ol |
| SMILES | C=CC1C(C=C)[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C15H28O2Si/c1-8-11-12(9-2)14(10-13(11)16)17-18(6,7)15(3,4)5/h8-9,11-14,16H,1-2,10H2,3-7H3/t11?,12?,13-,14+/m0/s1 |
| InChIKey | FCPCWSYLSDYQQZ-CLRIEMFWSA-N |
| XLogP | 3.75 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|