C20H36F2O3Si — CID 70592977
(1R,2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(3S)-4,4-difluoro-3-hydroxyoct-1-enyl]-3-methylidenecyclopentan-1-ol (PubChem CID 70592977) has the molecular formula C20H36F2O3Si and a molecular weight of 390.59 g/mol. Its IUPAC name is (1R,2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(3S)-4,4-difluoro-3-hydroxyoct-1-enyl]-3-methylidenecyclopentan-1-ol.
| Compound Name | (1R,2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(3S)-4,4-difluoro-3-hydroxyoct-1-enyl]-3-methylidenecyclopentan-1-ol |
|---|---|
| PubChem CID | 70592977 |
| Molecular Formula | C20H36F2O3Si |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (1R,2R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(3S)-4,4-difluoro-3-hydroxyoct-1-enyl]-3-methylidenecyclopentan-1-ol |
| SMILES | C=C1[C@@H](C=C[C@H](O)C(F)(F)CCCC)[C@H](O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H36F2O3Si/c1-8-9-12-20(21,22)18(24)11-10-15-14(2)17(13-16(15)23)25-26(6,7)19(3,4)5/h10-11,15-18,23-24H,2,8-9,12-13H2,1,3-7H3/t15-,16-,17-,18+/m1/s1 |
| InChIKey | BZDJSGADKGYXCJ-TVFCKZIOSA-N |
| XLogP | 5.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|