C23H48O3Si2 — CID 15343617
[(1R,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(Z)-pent-2-enyl]cyclopentyl]methanol (PubChem CID 15343617) has the molecular formula C23H48O3Si2 and a molecular weight of 428.81 g/mol. Its IUPAC name is [(1R,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(Z)-pent-2-enyl]cyclopentyl]methanol.
| Compound Name | [(1R,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(Z)-pent-2-enyl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 15343617 |
| Molecular Formula | C23H48O3Si2 |
| Molecular Weight | 428.81 g/mol |
| Exact Mass | 428.31 |
| IUPAC Name | [(1R,2R,3R,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(Z)-pent-2-enyl]cyclopentyl]methanol |
| SMILES | CC/C=C\C[C@@H]1[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H48O3Si2/c1-12-13-14-15-18-19(17-24)21(26-28(10,11)23(5,6)7)16-20(18)25-27(8,9)22(2,3)4/h13-14,18-21,24H,12,15-17H2,1-11H3/b14-13-/t18-,19+,20-,21+/m1/s1 |
| InChIKey | SLSXDIMCHHZCJA-SFOQPGNDSA-N |
| XLogP | 6.75 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.81 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|