C22H45FO3PSi+ — CID 90814847
[4-fluoro-1-[(1R)-2-[(Z)-hept-2-enyl]-3-hydroxy-5-phosphanyloxycyclopentyl]octan-3-yl]oxy-dimethylsilanylium (PubChem CID 90814847) has the molecular formula C22H45FO3PSi+ and a molecular weight of 435.66 g/mol. Its IUPAC name is [4-fluoro-1-[(1R)-2-[(Z)-hept-2-enyl]-3-hydroxy-5-phosphanyloxycyclopentyl]octan-3-yl]oxy-dimethylsilanylium.
| Compound Name | [4-fluoro-1-[(1R)-2-[(Z)-hept-2-enyl]-3-hydroxy-5-phosphanyloxycyclopentyl]octan-3-yl]oxy-dimethylsilanylium |
|---|---|
| PubChem CID | 90814847 |
| Molecular Formula | C22H45FO3PSi+ |
| Molecular Weight | 435.66 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | [4-fluoro-1-[(1R)-2-[(Z)-hept-2-enyl]-3-hydroxy-5-phosphanyloxycyclopentyl]octan-3-yl]oxy-dimethylsilanylium |
| SMILES | CCCC/C=C\CC1C(O)CC(OP)[C@@H]1CCC(O[SiH2+](C)C)C(F)CCCC |
| InChI | InChI=1S/C22H45FO3PSi/c1-5-7-9-10-11-12-17-18(22(25-27)16-20(17)24)14-15-21(26-28(3)4)19(23)13-8-6-2/h10-11,17-22,24H,5-9,12-16,27-28H2,1-4H3/q+1/b11-10-/t17?,18-,19?,20?,21?,22?/m1/s1 |
| InChIKey | YZEXFGQAGISKLY-CYXGNIFXSA-N |
| XLogP | 5.70 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.66 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|