C13H24FO2P — CID 59878786
[(1S,2R)-5-fluoro-2-[(Z)-hept-2-enyl]-3-phosphanyloxycyclopentyl]methanol (PubChem CID 59878786) has the molecular formula C13H24FO2P and a molecular weight of 262.30 g/mol. Its IUPAC name is [(1S,2R)-5-fluoro-2-[(Z)-hept-2-enyl]-3-phosphanyloxycyclopentyl]methanol.
| Compound Name | [(1S,2R)-5-fluoro-2-[(Z)-hept-2-enyl]-3-phosphanyloxycyclopentyl]methanol |
|---|---|
| PubChem CID | 59878786 |
| Molecular Formula | C13H24FO2P |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | [(1S,2R)-5-fluoro-2-[(Z)-hept-2-enyl]-3-phosphanyloxycyclopentyl]methanol |
| SMILES | CCCC/C=C\C[C@H]1C(OP)CC(F)[C@@H]1CO |
| InChI | InChI=1S/C13H24FO2P/c1-2-3-4-5-6-7-10-11(9-15)12(14)8-13(10)16-17/h5-6,10-13,15H,2-4,7-9,17H2,1H3/b6-5-/t10-,11-,12?,13?/m1/s1 |
| InChIKey | WWKOOYVOGGADPG-PURILOCQSA-N |
| XLogP | 3.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|