C15H26F2IO3P — CID 143807305
2-[(1R,3R)-2-[(E)-3,3-difluorooct-1-enyl]-3-iodophosphanyloxycyclopentyl]ethane-1,1-diol (PubChem CID 143807305) has the molecular formula C15H26F2IO3P and a molecular weight of 450.24 g/mol. Its IUPAC name is 2-[(1R,3R)-2-[(E)-3,3-difluorooct-1-enyl]-3-iodophosphanyloxycyclopentyl]ethane-1,1-diol.
| Compound Name | 2-[(1R,3R)-2-[(E)-3,3-difluorooct-1-enyl]-3-iodophosphanyloxycyclopentyl]ethane-1,1-diol |
|---|---|
| PubChem CID | 143807305 |
| Molecular Formula | C15H26F2IO3P |
| Molecular Weight | 450.24 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 2-[(1R,3R)-2-[(E)-3,3-difluorooct-1-enyl]-3-iodophosphanyloxycyclopentyl]ethane-1,1-diol |
| SMILES | CCCCCC(F)(F)/C=C/C1[C@@H](CC(O)O)CC[C@H]1OPI |
| InChI | InChI=1S/C15H26F2IO3P/c1-2-3-4-8-15(16,17)9-7-12-11(10-14(19)20)5-6-13(12)21-22-18/h7,9,11-14,19-20,22H,2-6,8,10H2,1H3/b9-7+/t11-,12?,13-/m1/s1 |
| InChIKey | QNYFZNZCOQMRSW-FKECWSHNSA-N |
| XLogP | 4.81 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.24 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|