C14H26FOP — CID 59878798
[(2R,3R)-3-ethyl-4-fluoro-2-[(Z)-hept-3-enyl]cyclopentyl]oxyphosphane (PubChem CID 59878798) has the molecular formula C14H26FOP and a molecular weight of 260.33 g/mol. Its IUPAC name is [(2R,3R)-3-ethyl-4-fluoro-2-[(Z)-hept-3-enyl]cyclopentyl]oxyphosphane.
| Compound Name | [(2R,3R)-3-ethyl-4-fluoro-2-[(Z)-hept-3-enyl]cyclopentyl]oxyphosphane |
|---|---|
| PubChem CID | 59878798 |
| Molecular Formula | C14H26FOP |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | [(2R,3R)-3-ethyl-4-fluoro-2-[(Z)-hept-3-enyl]cyclopentyl]oxyphosphane |
| SMILES | CCC/C=C\CC[C@H]1C(OP)CC(F)[C@@H]1CC |
| InChI | InChI=1S/C14H26FOP/c1-3-5-6-7-8-9-12-11(4-2)13(15)10-14(12)16-17/h6-7,11-14H,3-5,8-10,17H2,1-2H3/b7-6-/t11-,12-,13?,14?/m1/s1 |
| InChIKey | GAYOZSMVVSFUKP-FGIOOGJFSA-N |
| XLogP | 4.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|