C14H25FO — CID 59065313
(1S,2R,3R,4S)-3-ethyl-4-fluoro-2-[(Z)-hept-2-enyl]cyclopentan-1-ol (PubChem CID 59065313) has the molecular formula C14H25FO and a molecular weight of 228.35 g/mol. Its IUPAC name is (1S,2R,3R,4S)-3-ethyl-4-fluoro-2-[(Z)-hept-2-enyl]cyclopentan-1-ol.
| Compound Name | (1S,2R,3R,4S)-3-ethyl-4-fluoro-2-[(Z)-hept-2-enyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 59065313 |
| Molecular Formula | C14H25FO |
| Molecular Weight | 228.35 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | (1S,2R,3R,4S)-3-ethyl-4-fluoro-2-[(Z)-hept-2-enyl]cyclopentan-1-ol |
| SMILES | CCCC/C=C\C[C@@H]1[C@@H](CC)[C@@H](F)C[C@@H]1O |
| InChI | InChI=1S/C14H25FO/c1-3-5-6-7-8-9-12-11(4-2)13(15)10-14(12)16/h7-8,11-14,16H,3-6,9-10H2,1-2H3/b8-7-/t11-,12-,13+,14+/m1/s1 |
| InChIKey | ZXTQPVLFWAKDPX-RUJGPOQESA-N |
| XLogP | 3.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|