C14H24FO4P — CID 59878818
methyl (Z)-7-[(1R,2S)-3-fluoro-2-(hydroxymethyl)-5-phosphanyloxycyclopentyl]hept-5-enoate (PubChem CID 59878818) has the molecular formula C14H24FO4P and a molecular weight of 306.31 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2S)-3-fluoro-2-(hydroxymethyl)-5-phosphanyloxycyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2S)-3-fluoro-2-(hydroxymethyl)-5-phosphanyloxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 59878818 |
| Molecular Formula | C14H24FO4P |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | methyl (Z)-7-[(1R,2S)-3-fluoro-2-(hydroxymethyl)-5-phosphanyloxycyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@H]1C(OP)CC(F)[C@@H]1CO |
| InChI | InChI=1S/C14H24FO4P/c1-18-14(17)7-5-3-2-4-6-10-11(9-16)12(15)8-13(10)19-20/h2,4,10-13,16H,3,5-9,20H2,1H3/b4-2-/t10-,11-,12?,13?/m1/s1 |
| InChIKey | PKWAUSFSKFJYCY-HFNYGAIWSA-N |
| XLogP | 2.42 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|