C13H21FO3 — CID 67796956
methyl (Z)-6-[(1R,2R,5S)-2-fluoro-5-(hydroxymethyl)cyclopentyl]hex-4-enoate (PubChem CID 67796956) has the molecular formula C13H21FO3 and a molecular weight of 244.31 g/mol. Its IUPAC name is methyl (Z)-6-[(1R,2R,5S)-2-fluoro-5-(hydroxymethyl)cyclopentyl]hex-4-enoate.
| Compound Name | methyl (Z)-6-[(1R,2R,5S)-2-fluoro-5-(hydroxymethyl)cyclopentyl]hex-4-enoate |
|---|---|
| PubChem CID | 67796956 |
| Molecular Formula | C13H21FO3 |
| Molecular Weight | 244.31 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | methyl (Z)-6-[(1R,2R,5S)-2-fluoro-5-(hydroxymethyl)cyclopentyl]hex-4-enoate |
| SMILES | COC(=O)CC/C=C\C[C@@H]1[C@@H](CO)CC[C@H]1F |
| InChI | InChI=1S/C13H21FO3/c1-17-13(16)6-4-2-3-5-11-10(9-15)7-8-12(11)14/h2-3,10-12,15H,4-9H2,1H3/b3-2-/t10-,11-,12-/m1/s1 |
| InChIKey | PKJGSUDYFOHRAI-QIOFFNHISA-N |
| XLogP | 2.24 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|