C14H24O2 — CID 72593148
methyl 2-(3-methyl-2-pent-2-enylcyclopentyl)acetate (PubChem CID 72593148) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is methyl 2-(3-methyl-2-pent-2-enylcyclopentyl)acetate.
| Compound Name | methyl 2-(3-methyl-2-pent-2-enylcyclopentyl)acetate |
|---|---|
| PubChem CID | 72593148 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | methyl 2-(3-methyl-2-pent-2-enylcyclopentyl)acetate |
| SMILES | CCC=CCC1C(C)CCC1CC(=O)OC |
| InChI | InChI=1S/C14H24O2/c1-4-5-6-7-13-11(2)8-9-12(13)10-14(15)16-3/h5-6,11-13H,4,7-10H2,1-3H3 |
| InChIKey | AUSREOZWRZNKNJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|