C27H46O4 — CID 90951221
2-[3-hydroxy-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid;1-(2-methoxyprop-2-enyl)-3-methyl-2-[(Z)-pent-2-enyl]cyclopentane (PubChem CID 90951221) has the molecular formula C27H46O4 and a molecular weight of 434.66 g/mol. Its IUPAC name is 2-[3-hydroxy-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid;1-(2-methoxyprop-2-enyl)-3-methyl-2-[(Z)-pent-2-enyl]cyclopentane.
| Compound Name | 2-[3-hydroxy-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid;1-(2-methoxyprop-2-enyl)-3-methyl-2-[(Z)-pent-2-enyl]cyclopentane |
|---|---|
| PubChem CID | 90951221 |
| Molecular Formula | C27H46O4 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | 2-[3-hydroxy-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid;1-(2-methoxyprop-2-enyl)-3-methyl-2-[(Z)-pent-2-enyl]cyclopentane |
| SMILES | C=C(CC1CCC(C)C1C/C=C\CC)OC.CC/C=C\CC1C(O)CCC1CC(=O)O |
| InChI | InChI=1S/C15H26O.C12H20O3/c1-5-6-7-8-15-12(2)9-10-14(15)11-13(3)16-4;1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h6-7,12,14-15H,3,5,8-11H2,1-2,4H3;3-4,9-11,13H,2,5-8H2,1H3,(H,14,15)/b7-6-;4-3- |
| InChIKey | OSZCLUSOYKIIEF-BPMFRKFSSA-N |
| XLogP | 6.76 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|