C12H18O3 — CID 7067458
2-[(1R,2S)-3-oxo-2-pent-2-enylcyclopentyl]acetic acid (PubChem CID 7067458) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 2-[(1R,2S)-3-oxo-2-pent-2-enylcyclopentyl]acetic acid.
| Compound Name | 2-[(1R,2S)-3-oxo-2-pent-2-enylcyclopentyl]acetic acid |
|---|---|
| PubChem CID | 7067458 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 2-[(1R,2S)-3-oxo-2-pent-2-enylcyclopentyl]acetic acid |
| SMILES | CCC=CC[C@@H]1C(=O)CC[C@@H]1CC(=O)O |
| InChI | InChI=1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/t9-,10+/m1/s1 |
| InChIKey | ZNJFBWYDHIGLCU-ZJUUUORDSA-N |
| XLogP | 2.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|