C12H19ClO3 — CID 175288857
2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid;hydrochloride (PubChem CID 175288857) has the molecular formula C12H19ClO3 and a molecular weight of 246.73 g/mol. Its IUPAC name is 2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid;hydrochloride.
| Compound Name | 2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 175288857 |
| Molecular Formula | C12H19ClO3 |
| Molecular Weight | 246.73 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 2-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetic acid;hydrochloride |
| SMILES | CC/C=C\C[C@@H]1C(=O)CC[C@H]1CC(=O)O.Cl |
| InChI | InChI=1S/C12H18O3.ClH/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13;/h3-4,9-10H,2,5-8H2,1H3,(H,14,15);1H/b4-3-;/t9-,10-;/m0./s1 |
| InChIKey | VMDWAXYHRGWMFT-UFKNRWLNSA-N |
| XLogP | 2.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.73 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|