C15H23NO4 — CID 146037330
(2S)-2-[[2-[3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]propanoic acid (PubChem CID 146037330) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is (2S)-2-[[2-[3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[2-[3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 146037330 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (2S)-2-[[2-[3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]propanoic acid |
| SMILES | CC/C=C\CC1C(=O)CCC1CC(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C15H23NO4/c1-3-4-5-6-12-11(7-8-13(12)17)9-14(18)16-10(2)15(19)20/h4-5,10-12H,3,6-9H2,1-2H3,(H,16,18)(H,19,20)/b5-4-/t10-,11?,12?/m0/s1 |
| InChIKey | GQOBLZKNJFFBSM-TUUNCMNISA-N |
| XLogP | 1.92 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|