C18H31NO3 — CID 100938811
N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetamide (PubChem CID 100938811) has the molecular formula C18H31NO3 and a molecular weight of 309.45 g/mol. Its IUPAC name is N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetamide.
| Compound Name | N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetamide |
|---|---|
| PubChem CID | 100938811 |
| Molecular Formula | C18H31NO3 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.23 |
| IUPAC Name | N-[(2S,3S)-1-hydroxy-3-methylpentan-2-yl]-2-[(1R,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetamide |
| SMILES | CC/C=C\C[C@H]1C(=O)CC[C@@H]1CC(=O)N[C@H](CO)[C@@H](C)CC |
| InChI | InChI=1S/C18H31NO3/c1-4-6-7-8-15-14(9-10-17(15)21)11-18(22)19-16(12-20)13(3)5-2/h6-7,13-16,20H,4-5,8-12H2,1-3H3,(H,19,22)/b7-6-/t13-,14+,15+,16+/m0/s1 |
| InChIKey | YLHGEDDGCIVMFE-DOBCRSMGSA-N |
| XLogP | 2.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|