C26H40Br2O6 — CID 158002521
methyl 2-[2-(2,3-dibromopentyl)-3-oxocyclopentyl]acetate;methyl 2-[3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetate (PubChem CID 158002521) has the molecular formula C26H40Br2O6 and a molecular weight of 608.41 g/mol. Its IUPAC name is methyl 2-[2-(2,3-dibromopentyl)-3-oxocyclopentyl]acetate;methyl 2-[3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetate.
| Compound Name | methyl 2-[2-(2,3-dibromopentyl)-3-oxocyclopentyl]acetate;methyl 2-[3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 158002521 |
| Molecular Formula | C26H40Br2O6 |
| Molecular Weight | 608.41 g/mol |
| Exact Mass | 606.12 |
| IUPAC Name | methyl 2-[2-(2,3-dibromopentyl)-3-oxocyclopentyl]acetate;methyl 2-[3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetate |
| SMILES | CC/C=C\CC1C(=O)CCC1CC(=O)OC.CCC(Br)C(Br)CC1C(=O)CCC1CC(=O)OC |
| InChI | InChI=1S/C13H20Br2O3.C13H20O3/c1-3-10(14)11(15)7-9-8(4-5-12(9)16)6-13(17)18-2;1-3-4-5-6-11-10(7-8-12(11)14)9-13(15)16-2/h8-11H,3-7H2,1-2H3;4-5,10-11H,3,6-9H2,1-2H3/b;5-4- |
| InChIKey | FDXCELAGQYPPPH-GUHKXDMSSA-N |
| XLogP | 5.97 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.41 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|