C13H17F3O3 — CID 10707708
methyl 2-[(1R,2R)-3-oxo-2-[(Z)-5,5,5-trifluoropent-2-enyl]cyclopentyl]acetate (PubChem CID 10707708) has the molecular formula C13H17F3O3 and a molecular weight of 278.27 g/mol. Its IUPAC name is methyl 2-[(1R,2R)-3-oxo-2-[(Z)-5,5,5-trifluoropent-2-enyl]cyclopentyl]acetate.
| Compound Name | methyl 2-[(1R,2R)-3-oxo-2-[(Z)-5,5,5-trifluoropent-2-enyl]cyclopentyl]acetate |
|---|---|
| PubChem CID | 10707708 |
| Molecular Formula | C13H17F3O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | methyl 2-[(1R,2R)-3-oxo-2-[(Z)-5,5,5-trifluoropent-2-enyl]cyclopentyl]acetate |
| SMILES | COC(=O)C[C@H]1CCC(=O)[C@@H]1C/C=C\CC(F)(F)F |
| InChI | InChI=1S/C13H17F3O3/c1-19-12(18)8-9-5-6-11(17)10(9)4-2-3-7-13(14,15)16/h2-3,9-10H,4-8H2,1H3/b3-2-/t9-,10-/m1/s1 |
| InChIKey | GIOZXVAPAPEYAI-JAFKPYBISA-N |
| XLogP | 3.04 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|