C22H32N2O6 — CID 102489020
(2,5-dioxopyrrolidin-1-yl) (2S,3S)-3-methyl-2-[[2-[3-oxo-2-[(E)-pent-2-enyl]cyclopentyl]acetyl]amino]pentanoate (PubChem CID 102489020) has the molecular formula C22H32N2O6 and a molecular weight of 420.51 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) (2S,3S)-3-methyl-2-[[2-[3-oxo-2-[(E)-pent-2-enyl]cyclopentyl]acetyl]amino]pentanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) (2S,3S)-3-methyl-2-[[2-[3-oxo-2-[(E)-pent-2-enyl]cyclopentyl]acetyl]amino]pentanoate |
|---|---|
| PubChem CID | 102489020 |
| Molecular Formula | C22H32N2O6 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) (2S,3S)-3-methyl-2-[[2-[3-oxo-2-[(E)-pent-2-enyl]cyclopentyl]acetyl]amino]pentanoate |
| SMILES | CC/C=C/CC1C(=O)CCC1CC(=O)N[C@H](C(=O)ON1C(=O)CCC1=O)[C@@H](C)CC |
| InChI | InChI=1S/C22H32N2O6/c1-4-6-7-8-16-15(9-10-17(16)25)13-18(26)23-21(14(3)5-2)22(29)30-24-19(27)11-12-20(24)28/h6-7,14-16,21H,4-5,8-13H2,1-3H3,(H,23,26)/b7-6+/t14-,15?,16?,21-/m0/s1 |
| InChIKey | KTIORGAZRCVWGR-CIBFGUNHSA-N |
| XLogP | 2.47 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|