C21H37NO4 — CID 144809041
methoxymethane;3-methyl-2-[[2-[3-methylidene-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]pentanoic acid (PubChem CID 144809041) has the molecular formula C21H37NO4 and a molecular weight of 367.53 g/mol. Its IUPAC name is methoxymethane;3-methyl-2-[[2-[3-methylidene-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]pentanoic acid.
| Compound Name | methoxymethane;3-methyl-2-[[2-[3-methylidene-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 144809041 |
| Molecular Formula | C21H37NO4 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.27 |
| IUPAC Name | methoxymethane;3-methyl-2-[[2-[3-methylidene-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]pentanoic acid |
| SMILES | C=C1CCC(CC(=O)NC(C(=O)O)C(C)CC)C1C/C=C\CC.COC |
| InChI | InChI=1S/C19H31NO3.C2H6O/c1-5-7-8-9-16-14(4)10-11-15(16)12-17(21)20-18(19(22)23)13(3)6-2;1-3-2/h7-8,13,15-16,18H,4-6,9-12H2,1-3H3,(H,20,21)(H,22,23);1-2H3/b8-7-; |
| InChIKey | OVFXNDHNAHTNKF-CFYXSCKTSA-N |
| XLogP | 4.19 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|