C18H29NO5 — CID 162823326
(2S,3S)-2-[[2-[(1S,2R)-2-hydroxy-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]-3-methylpentanoic acid (PubChem CID 162823326) has the molecular formula C18H29NO5 and a molecular weight of 339.43 g/mol. Its IUPAC name is (2S,3S)-2-[[2-[(1S,2R)-2-hydroxy-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[[2-[(1S,2R)-2-hydroxy-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 162823326 |
| Molecular Formula | C18H29NO5 |
| Molecular Weight | 339.43 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | (2S,3S)-2-[[2-[(1S,2R)-2-hydroxy-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]acetyl]amino]-3-methylpentanoic acid |
| SMILES | CC/C=C\C[C@]1(O)C(=O)CC[C@H]1CC(=O)N[C@H](C(=O)O)[C@@H](C)CC |
| InChI | InChI=1S/C18H29NO5/c1-4-6-7-10-18(24)13(8-9-14(18)20)11-15(21)19-16(17(22)23)12(3)5-2/h6-7,12-13,16,24H,4-5,8-11H2,1-3H3,(H,19,21)(H,22,23)/b7-6-/t12-,13-,16-,18+/m0/s1 |
| InChIKey | NWEIZGILJOXCCO-YMTGJHKWSA-N |
| XLogP | 2.06 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|