C19H29NO4 — CID 91752069
methyl 3-methyl-2-[[2-[(1R,2S)-3-oxo-2-[(2E)-penta-2,4-dienyl]cyclopentyl]acetyl]amino]pentanoate (PubChem CID 91752069) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is methyl 3-methyl-2-[[2-[(1R,2S)-3-oxo-2-[(2E)-penta-2,4-dienyl]cyclopentyl]acetyl]amino]pentanoate.
| Compound Name | methyl 3-methyl-2-[[2-[(1R,2S)-3-oxo-2-[(2E)-penta-2,4-dienyl]cyclopentyl]acetyl]amino]pentanoate |
|---|---|
| PubChem CID | 91752069 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | methyl 3-methyl-2-[[2-[(1R,2S)-3-oxo-2-[(2E)-penta-2,4-dienyl]cyclopentyl]acetyl]amino]pentanoate |
| SMILES | C=C/C=C/C[C@@H]1C(=O)CC[C@@H]1CC(=O)NC(C(=O)OC)C(C)CC |
| InChI | InChI=1S/C19H29NO4/c1-5-7-8-9-15-14(10-11-16(15)21)12-17(22)20-18(13(3)6-2)19(23)24-4/h5,7-8,13-15,18H,1,6,9-12H2,2-4H3,(H,20,22)/b8-7+/t13?,14-,15+,18?/m1/s1 |
| InChIKey | MDFCXIXKDNKNPM-NYVRZKQMSA-N |
| XLogP | 2.81 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|