C20H33NO4 — CID 91752067
methyl 2-[[(1R,2S)-2-[(Z)-hept-2-enyl]-3-oxocyclopentanecarbonyl]amino]-3-methylpentanoate (PubChem CID 91752067) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is methyl 2-[[(1R,2S)-2-[(Z)-hept-2-enyl]-3-oxocyclopentanecarbonyl]amino]-3-methylpentanoate.
| Compound Name | methyl 2-[[(1R,2S)-2-[(Z)-hept-2-enyl]-3-oxocyclopentanecarbonyl]amino]-3-methylpentanoate |
|---|---|
| PubChem CID | 91752067 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | methyl 2-[[(1R,2S)-2-[(Z)-hept-2-enyl]-3-oxocyclopentanecarbonyl]amino]-3-methylpentanoate |
| SMILES | CCCC/C=C\C[C@@H]1C(=O)CC[C@H]1C(=O)NC(C(=O)OC)C(C)CC |
| InChI | InChI=1S/C20H33NO4/c1-5-7-8-9-10-11-15-16(12-13-17(15)22)19(23)21-18(14(3)6-2)20(24)25-4/h9-10,14-16,18H,5-8,11-13H2,1-4H3,(H,21,23)/b10-9-/t14?,15-,16+,18?/m0/s1 |
| InChIKey | QGYGIGLKPMEWPT-NPGYTWMYSA-N |
| XLogP | 3.42 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|