C13H17NO3 — CID 13323873
cis-(1S,2R)-2-[(Z)-6-cyanohex-2-enyl]-3-oxocyclopentane-1-carboxylic acid (PubChem CID 13323873) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is cis-(1S,2R)-2-[(Z)-6-cyanohex-2-enyl]-3-oxocyclopentane-1-carboxylic acid.
| Compound Name | cis-(1S,2R)-2-[(Z)-6-cyanohex-2-enyl]-3-oxocyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 13323873 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | cis-(1S,2R)-2-[(Z)-6-cyanohex-2-enyl]-3-oxocyclopentane-1-carboxylic acid |
| SMILES | N#CCCC/C=C\C[C@H]1C(=O)CC[C@@H]1C(=O)O |
| InChI | InChI=1S/C13H17NO3/c14-9-5-3-1-2-4-6-10-11(13(16)17)7-8-12(10)15/h2,4,10-11H,1,3,5-8H2,(H,16,17)/b4-2-/t10-,11+/m1/s1 |
| InChIKey | MDGGIRHGKZVAMQ-ADAMHKFESA-N |
| XLogP | 2.31 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|