C10H18O4 — CID 146165035
methyl 2-(4-ethyl-2,3-dihydroxycyclopentyl)acetate (PubChem CID 146165035) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is methyl 2-(4-ethyl-2,3-dihydroxycyclopentyl)acetate.
| Compound Name | methyl 2-(4-ethyl-2,3-dihydroxycyclopentyl)acetate |
|---|---|
| PubChem CID | 146165035 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | methyl 2-(4-ethyl-2,3-dihydroxycyclopentyl)acetate |
| SMILES | CCC1CC(CC(=O)OC)C(O)C1O |
| InChI | InChI=1S/C10H18O4/c1-3-6-4-7(5-8(11)14-2)10(13)9(6)12/h6-7,9-10,12-13H,3-5H2,1-2H3 |
| InChIKey | LIBQYPWOFZXVTC-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |