methyl 2-[(2S,4S)-4-(2-methoxy-2-oxoethyl)thietan-2-yl]acetate

C9H14O4S — CID 70342297

IUPACmethyl 2-[(2S,4S)-4-(2-methoxy-2-oxoethyl)thietan-2-yl]acetate
SMILESCOC(=O)C[C@H]1C[C@H](CC(=O)OC)S1
InChIInChI=1S/C9H14O4S/c1-12-8(10)4-6-3-7(14-6)5-9(11)13-2/h6-7H,3-5H2,1-2H3/t6-,7-/m1/s1
InChIKeyFMFNEOZYISDRPP-RNFRBKRXSA-N
MW218.27 g/mol
LogP0.99
Rot. Bonds4

About methyl 2-[(2S,4S)-4-(2-methoxy-2-oxoethyl)thietan-2-yl]acetate

methyl 2-[(2S,4S)-4-(2-methoxy-2-oxoethyl)thietan-2-yl]acetate (PubChem CID 70342297) has the molecular formula C9H14O4S and a molecular weight of 218.27 g/mol. Its IUPAC name is methyl 2-[(2S,4S)-4-(2-methoxy-2-oxoethyl)thietan-2-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[(2S,4S)-4-(2-methoxy-2-oxoethyl)thietan-2-yl]acetate
PubChem CID70342297
Molecular FormulaC9H14O4S
Molecular Weight218.27 g/mol
Exact Mass218.06
IUPAC Namemethyl 2-[(2S,4S)-4-(2-methoxy-2-oxoethyl)thietan-2-yl]acetate
SMILESCOC(=O)C[C@H]1C[C@H](CC(=O)OC)S1
InChIInChI=1S/C9H14O4S/c1-12-8(10)4-6-3-7(14-6)5-9(11)13-2/h6-7H,3-5H2,1-2H3/t6-,7-/m1/s1
InChIKeyFMFNEOZYISDRPP-RNFRBKRXSA-N
XLogP0.99
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.27
LogP ≤ 50.99
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-[(2S,4S)-4-(2-methoxy-2-oxoethyl)thietan-2-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(2S,4S)-4-(2-methoxy-2-oxoethyl)thietan-2-yl]acetate?
The IUPAC name of methyl 2-[(2S,4S)-4-(2-methoxy-2-oxoethyl)thietan-2-yl]acetate (CID 70342297) is methyl 2-[(2S,4S)-4-(2-methoxy-2-oxoethyl)thietan-2-yl]acetate.
What is the SMILES notation for methyl 2-[(2S,4S)-4-(2-methoxy-2-oxoethyl)thietan-2-yl]acetate?
The canonical SMILES for methyl 2-[(2S,4S)-4-(2-methoxy-2-oxoethyl)thietan-2-yl]acetate is COC(=O)C[C@H]1C[C@H](CC(=O)OC)S1.
What is the InChIKey of methyl 2-[(2S,4S)-4-(2-methoxy-2-oxoethyl)thietan-2-yl]acetate?
The InChIKey is FMFNEOZYISDRPP-RNFRBKRXSA-N. The full InChI is InChI=1S/C9H14O4S/c1-12-8(10)4-6-3-7(14-6)5-9(11)13-2/h6-7H,3-5H2,1-2H3/t6-,7-/m1/s1.
What are the key properties of methyl 2-[(2S,4S)-4-(2-methoxy-2-oxoethyl)thietan-2-yl]acetate?
methyl 2-[(2S,4S)-4-(2-methoxy-2-oxoethyl)thietan-2-yl]acetate has a molecular weight of 218.27 g/mol, XLogP of 0.99, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2S,4S)-4-(2-methoxy-2-oxoethyl)thietan-2-yl]acetate is sourced from PubChem (CID 70342297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).