About methyl 2-[(1R,3S,6S)-3-tricyclo[2.2.1.02,6]heptanyl]acetate
methyl 2-[(1R,3S,6S)-3-tricyclo[2.2.1.02,6]heptanyl]acetate (PubChem CID 131860871) has the molecular formula C10H14O2
and a molecular weight of 166.22 g/mol. Its IUPAC name is methyl 2-[(1R,3S,6S)-3-tricyclo[2.2.1.02,6]heptanyl]acetate.
Analyze methyl 2-[(1R,3S,6S)-3-tricyclo[2.2.1.02,6]heptanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(1R,3S,6S)-3-tricyclo[2.2.1.02,6]heptanyl]acetate?
The IUPAC name of methyl 2-[(1R,3S,6S)-3-tricyclo[2.2.1.02,6]heptanyl]acetate (CID 131860871) is methyl 2-[(1R,3S,6S)-3-tricyclo[2.2.1.02,6]heptanyl]acetate.
What is the SMILES notation for methyl 2-[(1R,3S,6S)-3-tricyclo[2.2.1.02,6]heptanyl]acetate?
The canonical SMILES for methyl 2-[(1R,3S,6S)-3-tricyclo[2.2.1.02,6]heptanyl]acetate is COC(=O)C[C@H]1C2C[C@@H]3C1[C@@H]3C2.
What is the InChIKey of methyl 2-[(1R,3S,6S)-3-tricyclo[2.2.1.02,6]heptanyl]acetate?
The InChIKey is WCGDMMTVCOTIBT-PNKGBSEUSA-N. The full InChI is InChI=1S/C10H14O2/c1-12-9(11)4-6-5-2-7-8(3-5)10(6)7/h5-8,10H,2-4H2,1H3/t5?,6-,7-,8+,10?/m0/s1.
What are the key properties of methyl 2-[(1R,3S,6S)-3-tricyclo[2.2.1.02,6]heptanyl]acetate?
methyl 2-[(1R,3S,6S)-3-tricyclo[2.2.1.02,6]heptanyl]acetate has a molecular weight of 166.22 g/mol, XLogP of 1.45, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(1R,3S,6S)-3-tricyclo[2.2.1.02,6]heptanyl]acetate is sourced from PubChem (CID 131860871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).