methyl 7-[(1S,2R)-2-formylcyclopentyl]hept-5-enoate

C14H22O3 — CID 57105862

IUPACmethyl 7-[(1S,2R)-2-formylcyclopentyl]hept-5-enoate
SMILESCOC(=O)CCCC=CC[C@@H]1CCC[C@H]1C=O
InChIInChI=1S/C14H22O3/c1-17-14(16)10-5-3-2-4-7-12-8-6-9-13(12)11-15/h2,4,11-13H,3,5-10H2,1H3/t12-,13+/m1/s1
InChIKeyXIKMUGZIPZHZLS-OLZOCXBDSA-N
MW238.33 g/mol
LogP2.89
Rot. Bonds7

About methyl 7-[(1S,2R)-2-formylcyclopentyl]hept-5-enoate

methyl 7-[(1S,2R)-2-formylcyclopentyl]hept-5-enoate (PubChem CID 57105862) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is methyl 7-[(1S,2R)-2-formylcyclopentyl]hept-5-enoate.

Molecular Properties

Compound Namemethyl 7-[(1S,2R)-2-formylcyclopentyl]hept-5-enoate
PubChem CID57105862
Molecular FormulaC14H22O3
Molecular Weight238.33 g/mol
Exact Mass238.16
IUPAC Namemethyl 7-[(1S,2R)-2-formylcyclopentyl]hept-5-enoate
SMILESCOC(=O)CCCC=CC[C@@H]1CCC[C@H]1C=O
InChIInChI=1S/C14H22O3/c1-17-14(16)10-5-3-2-4-7-12-8-6-9-13(12)11-15/h2,4,11-13H,3,5-10H2,1H3/t12-,13+/m1/s1
InChIKeyXIKMUGZIPZHZLS-OLZOCXBDSA-N
XLogP2.89
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.33
LogP ≤ 52.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze methyl 7-[(1S,2R)-2-formylcyclopentyl]hept-5-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 7-[(1S,2R)-2-formylcyclopentyl]hept-5-enoate?
The IUPAC name of methyl 7-[(1S,2R)-2-formylcyclopentyl]hept-5-enoate (CID 57105862) is methyl 7-[(1S,2R)-2-formylcyclopentyl]hept-5-enoate.
What is the SMILES notation for methyl 7-[(1S,2R)-2-formylcyclopentyl]hept-5-enoate?
The canonical SMILES for methyl 7-[(1S,2R)-2-formylcyclopentyl]hept-5-enoate is COC(=O)CCCC=CC[C@@H]1CCC[C@H]1C=O.
What is the InChIKey of methyl 7-[(1S,2R)-2-formylcyclopentyl]hept-5-enoate?
The InChIKey is XIKMUGZIPZHZLS-OLZOCXBDSA-N. The full InChI is InChI=1S/C14H22O3/c1-17-14(16)10-5-3-2-4-7-12-8-6-9-13(12)11-15/h2,4,11-13H,3,5-10H2,1H3/t12-,13+/m1/s1.
What are the key properties of methyl 7-[(1S,2R)-2-formylcyclopentyl]hept-5-enoate?
methyl 7-[(1S,2R)-2-formylcyclopentyl]hept-5-enoate has a molecular weight of 238.33 g/mol, XLogP of 2.89, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 7-[(1S,2R)-2-formylcyclopentyl]hept-5-enoate is sourced from PubChem (CID 57105862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).