C20H36O2S — CID 54215965
methyl 7-[(1R,2S)-2-heptylsulfanylcyclopentyl]hept-5-enoate (PubChem CID 54215965) has the molecular formula C20H36O2S and a molecular weight of 340.57 g/mol. Its IUPAC name is methyl 7-[(1R,2S)-2-heptylsulfanylcyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2S)-2-heptylsulfanylcyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 54215965 |
| Molecular Formula | C20H36O2S |
| Molecular Weight | 340.57 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | methyl 7-[(1R,2S)-2-heptylsulfanylcyclopentyl]hept-5-enoate |
| SMILES | CCCCCCCS[C@H]1CCC[C@@H]1CC=CCCCC(=O)OC |
| InChI | InChI=1S/C20H36O2S/c1-3-4-5-8-11-17-23-19-15-12-14-18(19)13-9-6-7-10-16-20(21)22-2/h6,9,18-19H,3-5,7-8,10-17H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | PZEVGNDPVGGNDX-OALUTQOASA-N |
| XLogP | 6.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.57 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|