About methanimine;methyl (Z)-7-(2-bicyclo[2.2.0]hexanyl)hept-5-enoate
methanimine;methyl (Z)-7-(2-bicyclo[2.2.0]hexanyl)hept-5-enoate (PubChem CID 142016184) has the molecular formula C15H25NO2
and a molecular weight of 251.37 g/mol. Its IUPAC name is methanimine;methyl (Z)-7-(2-bicyclo[2.2.0]hexanyl)hept-5-enoate.
Molecular Properties
| Compound Name | methanimine;methyl (Z)-7-(2-bicyclo[2.2.0]hexanyl)hept-5-enoate |
| PubChem CID | 142016184 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | methanimine;methyl (Z)-7-(2-bicyclo[2.2.0]hexanyl)hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\CC1CC2CCC12.[H]N=C |
| InChI | InChI=1S/C14H22O2.CH3N/c1-16-14(15)7-5-3-2-4-6-11-10-12-8-9-13(11)12;1-2/h2,4,11-13H,3,5-10H2,1H3;2H,1H2/b4-2-; |
| InChIKey | PRUIRXBPIKSAIJ-MKHFZPSSSA-N |
| XLogP | 3.59 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methanimine;methyl (Z)-7-(2-bicyclo[2.2.0]hexanyl)hept-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanimine;methyl (Z)-7-(2-bicyclo[2.2.0]hexanyl)hept-5-enoate?
The IUPAC name of methanimine;methyl (Z)-7-(2-bicyclo[2.2.0]hexanyl)hept-5-enoate (CID 142016184) is methanimine;methyl (Z)-7-(2-bicyclo[2.2.0]hexanyl)hept-5-enoate.
What is the SMILES notation for methanimine;methyl (Z)-7-(2-bicyclo[2.2.0]hexanyl)hept-5-enoate?
The canonical SMILES for methanimine;methyl (Z)-7-(2-bicyclo[2.2.0]hexanyl)hept-5-enoate is COC(=O)CCC/C=C\CC1CC2CCC12.[H]N=C.
What is the InChIKey of methanimine;methyl (Z)-7-(2-bicyclo[2.2.0]hexanyl)hept-5-enoate?
The InChIKey is PRUIRXBPIKSAIJ-MKHFZPSSSA-N. The full InChI is InChI=1S/C14H22O2.CH3N/c1-16-14(15)7-5-3-2-4-6-11-10-12-8-9-13(11)12;1-2/h2,4,11-13H,3,5-10H2,1H3;2H,1H2/b4-2-;.
What are the key properties of methanimine;methyl (Z)-7-(2-bicyclo[2.2.0]hexanyl)hept-5-enoate?
methanimine;methyl (Z)-7-(2-bicyclo[2.2.0]hexanyl)hept-5-enoate has a molecular weight of 251.37 g/mol, XLogP of 3.59, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanimine;methyl (Z)-7-(2-bicyclo[2.2.0]hexanyl)hept-5-enoate is sourced from PubChem (CID 142016184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).