C18H26O3 — CID 70623169
methyl (Z)-7-[(1R,4R)-3-(3-hydroxyprop-1-enyl)-2-bicyclo[2.2.1]hept-5-enyl]hept-5-enoate (PubChem CID 70623169) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,4R)-3-(3-hydroxyprop-1-enyl)-2-bicyclo[2.2.1]hept-5-enyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,4R)-3-(3-hydroxyprop-1-enyl)-2-bicyclo[2.2.1]hept-5-enyl]hept-5-enoate |
|---|---|
| PubChem CID | 70623169 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | methyl (Z)-7-[(1R,4R)-3-(3-hydroxyprop-1-enyl)-2-bicyclo[2.2.1]hept-5-enyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\CC1C(C=CCO)[C@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C18H26O3/c1-21-18(20)9-5-3-2-4-7-16-14-10-11-15(13-14)17(16)8-6-12-19/h2,4,6,8,10-11,14-17,19H,3,5,7,9,12-13H2,1H3/b4-2-,8-6?/t14-,15-,16?,17?/m0/s1 |
| InChIKey | CWJBBRWORLASDX-ITEZBLKMSA-N |
| XLogP | 3.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|