C24H29FO4 — CID 57339534
(E)-7-[(2S,3S)-3-[(E,3S)-4-(4-fluorophenoxy)-3-hydroxybut-1-enyl]-2-bicyclo[2.2.1]hept-5-enyl]hept-5-enoic acid (PubChem CID 57339534) has the molecular formula C24H29FO4 and a molecular weight of 400.49 g/mol. Its IUPAC name is (E)-7-[(2S,3S)-3-[(E,3S)-4-(4-fluorophenoxy)-3-hydroxybut-1-enyl]-2-bicyclo[2.2.1]hept-5-enyl]hept-5-enoic acid.
| Compound Name | (E)-7-[(2S,3S)-3-[(E,3S)-4-(4-fluorophenoxy)-3-hydroxybut-1-enyl]-2-bicyclo[2.2.1]hept-5-enyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57339534 |
| Molecular Formula | C24H29FO4 |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | (E)-7-[(2S,3S)-3-[(E,3S)-4-(4-fluorophenoxy)-3-hydroxybut-1-enyl]-2-bicyclo[2.2.1]hept-5-enyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C/C[C@H]1C2C=CC(C2)[C@@H]1/C=C/[C@H](O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C24H29FO4/c25-19-9-12-21(13-10-19)29-16-20(26)11-14-23-18-8-7-17(15-18)22(23)5-3-1-2-4-6-24(27)28/h1,3,7-14,17-18,20,22-23,26H,2,4-6,15-16H2,(H,27,28)/b3-1+,14-11+/t17?,18?,20-,22-,23-/m0/s1 |
| InChIKey | XBEXHWPCLKUYDD-IEEHTABBSA-N |
| XLogP | 4.76 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|