C26H35FO4 — CID 10477807
(Z)-7-[(1S,2S,3S,5S)-2-[(E,3R)-4-(4-fluorophenoxy)-3-hydroxybut-1-enyl]-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoic acid (PubChem CID 10477807) has the molecular formula C26H35FO4 and a molecular weight of 430.56 g/mol. Its IUPAC name is (Z)-7-[(1S,2S,3S,5S)-2-[(E,3R)-4-(4-fluorophenoxy)-3-hydroxybut-1-enyl]-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2S,3S,5S)-2-[(E,3R)-4-(4-fluorophenoxy)-3-hydroxybut-1-enyl]-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 10477807 |
| Molecular Formula | C26H35FO4 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (Z)-7-[(1S,2S,3S,5S)-2-[(E,3R)-4-(4-fluorophenoxy)-3-hydroxybut-1-enyl]-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]hept-5-enoic acid |
| SMILES | CC1(C)[C@H]2C[C@H](C/C=C\CCCC(=O)O)[C@@H](/C=C/[C@@H](O)COc3ccc(F)cc3)[C@@H]1C2 |
| InChI | InChI=1S/C26H35FO4/c1-26(2)19-15-18(7-5-3-4-6-8-25(29)30)23(24(26)16-19)14-11-21(28)17-31-22-12-9-20(27)10-13-22/h3,5,9-14,18-19,21,23-24,28H,4,6-8,15-17H2,1-2H3,(H,29,30)/b5-3-,14-11+/t18-,19-,21+,23+,24-/m0/s1 |
| InChIKey | YKQHIQPBQRIGTE-JAOXJEAYSA-N |
| XLogP | 5.62 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|