C20H37F2O3P — CID 59944040
(3R)-3-(4,4-difluoro-3-hydroxyoctyl)-2-[(Z)-hept-2-enyl]-4-phosphanyloxycyclopentan-1-ol (PubChem CID 59944040) has the molecular formula C20H37F2O3P and a molecular weight of 394.48 g/mol. Its IUPAC name is (3R)-3-(4,4-difluoro-3-hydroxyoctyl)-2-[(Z)-hept-2-enyl]-4-phosphanyloxycyclopentan-1-ol.
| Compound Name | (3R)-3-(4,4-difluoro-3-hydroxyoctyl)-2-[(Z)-hept-2-enyl]-4-phosphanyloxycyclopentan-1-ol |
|---|---|
| PubChem CID | 59944040 |
| Molecular Formula | C20H37F2O3P |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (3R)-3-(4,4-difluoro-3-hydroxyoctyl)-2-[(Z)-hept-2-enyl]-4-phosphanyloxycyclopentan-1-ol |
| SMILES | CCCC/C=C\CC1C(O)CC(OP)[C@@H]1CCC(O)C(F)(F)CCCC |
| InChI | InChI=1S/C20H37F2O3P/c1-3-5-7-8-9-10-15-16(18(25-26)14-17(15)23)11-12-19(24)20(21,22)13-6-4-2/h8-9,15-19,23-24H,3-7,10-14,26H2,1-2H3/b9-8-/t15?,16-,17?,18?,19?/m1/s1 |
| InChIKey | KJKDSKBVPKFWAI-RCZVRBOTSA-N |
| XLogP | 5.26 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|