C21H37F2O5P — CID 59944034
methyl (Z)-7-[(2R)-2-(4,4-difluoro-3-hydroxyoctyl)-5-hydroxy-3-phosphanyloxycyclopentyl]hept-5-enoate (PubChem CID 59944034) has the molecular formula C21H37F2O5P and a molecular weight of 438.49 g/mol. Its IUPAC name is methyl (Z)-7-[(2R)-2-(4,4-difluoro-3-hydroxyoctyl)-5-hydroxy-3-phosphanyloxycyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(2R)-2-(4,4-difluoro-3-hydroxyoctyl)-5-hydroxy-3-phosphanyloxycyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 59944034 |
| Molecular Formula | C21H37F2O5P |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | methyl (Z)-7-[(2R)-2-(4,4-difluoro-3-hydroxyoctyl)-5-hydroxy-3-phosphanyloxycyclopentyl]hept-5-enoate |
| SMILES | CCCCC(F)(F)C(O)CC[C@H]1C(OP)CC(O)C1C/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C21H37F2O5P/c1-3-4-13-21(22,23)19(25)12-11-16-15(17(24)14-18(16)28-29)9-7-5-6-8-10-20(26)27-2/h5,7,15-19,24-25H,3-4,6,8-14,29H2,1-2H3/b7-5-/t15?,16-,17?,18?,19?/m1/s1 |
| InChIKey | GDQIUFCUQQVPKF-BNFYDBSZSA-N |
| XLogP | 4.41 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|