C20H35F2O5P — CID 20672806
(E)-7-[2-(4,4-difluoro-3-hydroxyoctyl)-5-hydroxy-3-phosphanyloxycyclopentyl]hept-5-enoic acid (PubChem CID 20672806) has the molecular formula C20H35F2O5P and a molecular weight of 424.47 g/mol. Its IUPAC name is (E)-7-[2-(4,4-difluoro-3-hydroxyoctyl)-5-hydroxy-3-phosphanyloxycyclopentyl]hept-5-enoic acid.
| Compound Name | (E)-7-[2-(4,4-difluoro-3-hydroxyoctyl)-5-hydroxy-3-phosphanyloxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 20672806 |
| Molecular Formula | C20H35F2O5P |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | (E)-7-[2-(4,4-difluoro-3-hydroxyoctyl)-5-hydroxy-3-phosphanyloxycyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC(F)(F)C(O)CCC1C(OP)CC(O)C1C/C=C/CCCC(=O)O |
| InChI | InChI=1S/C20H35F2O5P/c1-2-3-12-20(21,22)18(24)11-10-15-14(16(23)13-17(15)27-28)8-6-4-5-7-9-19(25)26/h4,6,14-18,23-24H,2-3,5,7-13,28H2,1H3,(H,25,26)/b6-4+ |
| InChIKey | JHWWXVRORMWYKR-GQCTYLIASA-N |
| XLogP | 4.33 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|