C20H36FO5P — CID 59963456
(Z)-7-[(2R)-2-(4-fluoro-3-hydroxyoctyl)-5-hydroxy-3-phosphanyloxycyclopentyl]hept-5-enoic acid (PubChem CID 59963456) has the molecular formula C20H36FO5P and a molecular weight of 406.48 g/mol. Its IUPAC name is (Z)-7-[(2R)-2-(4-fluoro-3-hydroxyoctyl)-5-hydroxy-3-phosphanyloxycyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(2R)-2-(4-fluoro-3-hydroxyoctyl)-5-hydroxy-3-phosphanyloxycyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 59963456 |
| Molecular Formula | C20H36FO5P |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.23 |
| IUPAC Name | (Z)-7-[(2R)-2-(4-fluoro-3-hydroxyoctyl)-5-hydroxy-3-phosphanyloxycyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC(F)C(O)CC[C@H]1C(OP)CC(O)C1C/C=C\CCCC(=O)O |
| InChI | InChI=1S/C20H36FO5P/c1-2-3-9-16(21)17(22)12-11-15-14(18(23)13-19(15)26-27)8-6-4-5-7-10-20(24)25/h4,6,14-19,22-23H,2-3,5,7-13,27H2,1H3,(H,24,25)/b6-4-/t14?,15-,16?,17?,18?,19?/m1/s1 |
| InChIKey | LZYZPRDAFZLVGW-LGMLQODXSA-N |
| XLogP | 4.03 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|