C20H38FO3P — CID 20672775
3-(4-fluoro-3-hydroxyoctyl)-2-[(E)-hept-2-enyl]-4-phosphanyloxycyclopentan-1-ol (PubChem CID 20672775) has the molecular formula C20H38FO3P and a molecular weight of 376.49 g/mol. Its IUPAC name is 3-(4-fluoro-3-hydroxyoctyl)-2-[(E)-hept-2-enyl]-4-phosphanyloxycyclopentan-1-ol.
| Compound Name | 3-(4-fluoro-3-hydroxyoctyl)-2-[(E)-hept-2-enyl]-4-phosphanyloxycyclopentan-1-ol |
|---|---|
| PubChem CID | 20672775 |
| Molecular Formula | C20H38FO3P |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 3-(4-fluoro-3-hydroxyoctyl)-2-[(E)-hept-2-enyl]-4-phosphanyloxycyclopentan-1-ol |
| SMILES | CCCC/C=C/CC1C(O)CC(OP)C1CCC(O)C(F)CCCC |
| InChI | InChI=1S/C20H38FO3P/c1-3-5-7-8-9-10-15-16(20(24-25)14-19(15)23)12-13-18(22)17(21)11-6-4-2/h8-9,15-20,22-23H,3-7,10-14,25H2,1-2H3/b9-8+ |
| InChIKey | CENLPKYCFUKKMI-CMDGGOBGSA-N |
| XLogP | 4.96 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|