C23H44F2O5PSi+ — CID 91431850
[4,4-difluoro-1-[(1R)-3-hydroxy-2-(7-methoxy-7-oxohept-2-enyl)-5-phosphanyloxycyclopentyl]octan-3-yl]oxy-dimethylsilanylium (PubChem CID 91431850) has the molecular formula C23H44F2O5PSi+ and a molecular weight of 497.66 g/mol. Its IUPAC name is [4,4-difluoro-1-[(1R)-3-hydroxy-2-(7-methoxy-7-oxohept-2-enyl)-5-phosphanyloxycyclopentyl]octan-3-yl]oxy-dimethylsilanylium.
| Compound Name | [4,4-difluoro-1-[(1R)-3-hydroxy-2-(7-methoxy-7-oxohept-2-enyl)-5-phosphanyloxycyclopentyl]octan-3-yl]oxy-dimethylsilanylium |
|---|---|
| PubChem CID | 91431850 |
| Molecular Formula | C23H44F2O5PSi+ |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | [4,4-difluoro-1-[(1R)-3-hydroxy-2-(7-methoxy-7-oxohept-2-enyl)-5-phosphanyloxycyclopentyl]octan-3-yl]oxy-dimethylsilanylium |
| SMILES | CCCCC(F)(F)C(CC[C@H]1C(OP)CC(O)C1CC=CCCCC(=O)OC)O[SiH2+](C)C |
| InChI | InChI=1S/C23H44F2O5PSi/c1-5-6-15-23(24,25)21(30-32(3)4)14-13-18-17(19(26)16-20(18)29-31)11-9-7-8-10-12-22(27)28-2/h7,9,17-21,26H,5-6,8,10-16,31-32H2,1-4H3/q+1/t17?,18-,19?,20?,21?/m1/s1 |
| InChIKey | ULTMNTYSNSARQF-VGLNDMCTSA-N |
| XLogP | 5.15 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|