C32H62F2O4Si2 — CID 57164357
(7R)-7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooctyl]cyclopentyl]-7-fluorohept-5-enoic acid (PubChem CID 57164357) has the molecular formula C32H62F2O4Si2 and a molecular weight of 605.01 g/mol. Its IUPAC name is (7R)-7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooctyl]cyclopentyl]-7-fluorohept-5-enoic acid.
| Compound Name | (7R)-7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooctyl]cyclopentyl]-7-fluorohept-5-enoic acid |
|---|---|
| PubChem CID | 57164357 |
| Molecular Formula | C32H62F2O4Si2 |
| Molecular Weight | 605.01 g/mol |
| Exact Mass | 604.42 |
| IUPAC Name | (7R)-7-[(1S,2R,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-fluorooctyl]cyclopentyl]-7-fluorohept-5-enoic acid |
| SMILES | CCCC[C@H](F)[C@@H](CC[C@@H]1[C@@H]([C@H](F)C=CCCCC(=O)O)CC[C@H]1O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H62F2O4Si2/c1-12-13-17-27(34)29(38-40(10,11)32(5,6)7)23-21-25-24(26(33)18-15-14-16-19-30(35)36)20-22-28(25)37-39(8,9)31(2,3)4/h15,18,24-29H,12-14,16-17,19-23H2,1-11H3,(H,35,36)/t24-,25+,26+,27-,28+,29+/m0/s1 |
| InChIKey | ZPZCLUFPFYCEBG-YSWGYOQLSA-N |
| XLogP | 10.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.01 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|