C18H36FO3Si+ — CID 163897108
[(E)-1-[(2R,3S,5R)-3-ethoxy-5-hydroxy-2-methylcyclopentyl]-4-fluorooct-6-en-3-yl]oxy-dimethylsilanylium (PubChem CID 163897108) has the molecular formula C18H36FO3Si+ and a molecular weight of 347.57 g/mol. Its IUPAC name is [(E)-1-[(2R,3S,5R)-3-ethoxy-5-hydroxy-2-methylcyclopentyl]-4-fluorooct-6-en-3-yl]oxy-dimethylsilanylium.
| Compound Name | [(E)-1-[(2R,3S,5R)-3-ethoxy-5-hydroxy-2-methylcyclopentyl]-4-fluorooct-6-en-3-yl]oxy-dimethylsilanylium |
|---|---|
| PubChem CID | 163897108 |
| Molecular Formula | C18H36FO3Si+ |
| Molecular Weight | 347.57 g/mol |
| Exact Mass | 347.24 |
| IUPAC Name | [(E)-1-[(2R,3S,5R)-3-ethoxy-5-hydroxy-2-methylcyclopentyl]-4-fluorooct-6-en-3-yl]oxy-dimethylsilanylium |
| SMILES | C/C=C/CC(F)C(CCC1[C@H](O)C[C@H](OCC)[C@@H]1C)O[SiH2+](C)C |
| InChI | InChI=1S/C18H36FO3Si/c1-6-8-9-15(19)17(22-23(4)5)11-10-14-13(3)18(21-7-2)12-16(14)20/h6,8,13-18,20H,7,9-12,23H2,1-5H3/q+1/b8-6+/t13-,14?,15?,16-,17?,18+/m1/s1 |
| InChIKey | QUZMPRLHSBUZDI-IBMKDWNXSA-N |
| XLogP | 3.59 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|